Murphy, Michael, Spalding, Trevor R., Ferguson, George and Gallagher, John F.ORCID: 0000-0002-7112-7450
(1992)
[8,8-(PPh3)2-9-(OEt)-8,7-RhSB9H9].0.95(CH2Cl2).
Acta Crystallographica Section C, 48
(4).
pp. 638-641.
ISSN 0108-2701
9-Ethoxy-8,8-di(triphenylphosphine)-9,10-
tz H-8-rhoda-7-thia-nido-undecaborane( l O) dichloromethane
solvate, C38Ha4B9OP2RhS.0.95(CH2C12), Mr
= 891.7, triclinic, Pi, a = 10.271 (4), b = 11.401 (3), c
= 19.426 (4)/~, a = 74.86 (2), 13 = 88.51 (3), y =
83.51 (3) °, V= 2182 (2)/~3, Z= 2, Dx =
1.357 g cm-3, graphite-monochromated Mo Ka
radiation, a = 0.71073 A, /z = 6.5 cm-1, F(000) =
912, T= 294 K, R = 0.038 for 3984 observed reflections.
The title compound contains an l 1-atom
RhSB9 nido-structured cage with Rh and S atoms
adjacent in the open RhSB3 face. An ethoxy group is
bonded to the B atom adjacent to Rh in the open
face with Rh--B9 2.119 (6) and B9--O 1.387 (9)A.
The phosphine ligands are bonded to the Rh atom with one Rh--P bond [2.278 (2)A] trans to the S
atom and the other [2.417 (1) A] located perpendicular
to the open face of the cage.